C19H20F6O2 — CID 89475228
[1-propan-2-yl-5,6-bis(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-yl] 2-methylprop-2-enoate (PubChem CID 89475228) has the molecular formula C19H20F6O2 and a molecular weight of 394.36 g/mol. Its IUPAC name is [1-propan-2-yl-5,6-bis(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-yl] 2-methylprop-2-enoate.
| Compound Name | [1-propan-2-yl-5,6-bis(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89475228 |
| Molecular Formula | C19H20F6O2 |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | [1-propan-2-yl-5,6-bis(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(C(C)C)CCCc2c1ccc(C(F)(F)F)c2C(F)(F)F |
| InChI | InChI=1S/C19H20F6O2/c1-10(2)16(26)27-17(11(3)4)9-5-6-12-13(17)7-8-14(18(20,21)22)15(12)19(23,24)25/h7-8,11H,1,5-6,9H2,2-4H3 |
| InChIKey | XEEAJEXJFJKDQX-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|