About methyl 3-chloro-2-[2-(4,4-difluorocyclohexanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate
methyl 3-chloro-2-[2-(4,4-difluorocyclohexanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate (PubChem CID 89475503) has the molecular formula C18H19ClF2N4O3
and a molecular weight of 412.82 g/mol. Its IUPAC name is methyl 3-chloro-2-[2-(4,4-difluorocyclohexanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate.
Molecular Properties
| Compound Name | methyl 3-chloro-2-[2-(4,4-difluorocyclohexanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate |
| PubChem CID | 89475503 |
| Molecular Formula | C18H19ClF2N4O3 |
| Molecular Weight | 412.82 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | methyl 3-chloro-2-[2-(4,4-difluorocyclohexanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate |
| SMILES | COC(=O)c1cc2nc(Cl)c(NNC(=O)C3CCC(F)(F)CC3)nc2cc1C |
| InChI | InChI=1S/C18H19ClF2N4O3/c1-9-7-12-13(8-11(9)17(27)28-2)22-14(19)15(23-12)24-25-16(26)10-3-5-18(20,21)6-4-10/h7-8,10H,3-6H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | OTTYNQCWCRLDFI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.82 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-chloro-2-[2-(4,4-difluorocyclohexanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-chloro-2-[2-(4,4-difluorocyclohexanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate?
The IUPAC name of methyl 3-chloro-2-[2-(4,4-difluorocyclohexanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate (CID 89475503) is methyl 3-chloro-2-[2-(4,4-difluorocyclohexanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate.
What is the SMILES notation for methyl 3-chloro-2-[2-(4,4-difluorocyclohexanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate?
The canonical SMILES for methyl 3-chloro-2-[2-(4,4-difluorocyclohexanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate is COC(=O)c1cc2nc(Cl)c(NNC(=O)C3CCC(F)(F)CC3)nc2cc1C.
What is the InChIKey of methyl 3-chloro-2-[2-(4,4-difluorocyclohexanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate?
The InChIKey is OTTYNQCWCRLDFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19ClF2N4O3/c1-9-7-12-13(8-11(9)17(27)28-2)22-14(19)15(23-12)24-25-16(26)10-3-5-18(20,21)6-4-10/h7-8,10H,3-6H2,1-2H3,(H,23,24)(H,25,26).
What are the key properties of methyl 3-chloro-2-[2-(4,4-difluorocyclohexanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate?
methyl 3-chloro-2-[2-(4,4-difluorocyclohexanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate has a molecular weight of 412.82 g/mol, XLogP of 3.65, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-chloro-2-[2-(4,4-difluorocyclohexanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate is sourced from PubChem (CID 89475503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).