C29H28N2O2 — CID 89476003
ethyl 2-[[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]methyl]pyridine-4-carboxylate (PubChem CID 89476003) has the molecular formula C29H28N2O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is ethyl 2-[[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]methyl]pyridine-4-carboxylate.
| Compound Name | ethyl 2-[[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]methyl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 89476003 |
| Molecular Formula | C29H28N2O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | ethyl 2-[[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]methyl]pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1ccnc(CN2CCC(=C3c4ccccc4C=Cc4ccccc43)CC2)c1 |
| InChI | InChI=1S/C29H28N2O2/c1-2-33-29(32)24-13-16-30-25(19-24)20-31-17-14-23(15-18-31)28-26-9-5-3-7-21(26)11-12-22-8-4-6-10-27(22)28/h3-13,16,19H,2,14-15,17-18,20H2,1H3 |
| InChIKey | UJLDUBFTFNZWLC-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|