C18H21F3O2 — CID 89476022
2-[7-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]propan-2-yl 2-methylprop-2-enoate (PubChem CID 89476022) has the molecular formula C18H21F3O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is 2-[7-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]propan-2-yl 2-methylprop-2-enoate.
| Compound Name | 2-[7-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]propan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89476022 |
| Molecular Formula | C18H21F3O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 2-[7-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]propan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)C1CCCc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C18H21F3O2/c1-11(2)16(22)23-17(3,4)15-7-5-6-12-8-9-13(10-14(12)15)18(19,20)21/h8-10,15H,1,5-7H2,2-4H3 |
| InChIKey | ZSBNTYNTGOHQBP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|