About tert-butyl-dimethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]silane
tert-butyl-dimethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]silane (PubChem CID 89476029) has the molecular formula C14H26OSi
and a molecular weight of 238.45 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]silane.
Molecular Properties
| Compound Name | tert-butyl-dimethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]silane |
| PubChem CID | 89476029 |
| Molecular Formula | C14H26OSi |
| Molecular Weight | 238.45 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | tert-butyl-dimethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]silane |
| SMILES | C=C/C=C(\C=C/C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H26OSi/c1-8-10-13(11-9-2)12-15-16(6,7)14(3,4)5/h8-11H,1,12H2,2-7H3/b11-9-,13-10+ |
| InChIKey | JDKXFLDECZSLLU-SZJZEYKYSA-N |
| XLogP | 4.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-dimethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-dimethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]silane?
The IUPAC name of tert-butyl-dimethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]silane (CID 89476029) is tert-butyl-dimethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]silane.
What is the SMILES notation for tert-butyl-dimethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]silane?
The canonical SMILES for tert-butyl-dimethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]silane is C=C/C=C(\C=C/C)CO[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-dimethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]silane?
The InChIKey is JDKXFLDECZSLLU-SZJZEYKYSA-N. The full InChI is InChI=1S/C14H26OSi/c1-8-10-13(11-9-2)12-15-16(6,7)14(3,4)5/h8-11H,1,12H2,2-7H3/b11-9-,13-10+.
What are the key properties of tert-butyl-dimethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]silane?
tert-butyl-dimethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]silane has a molecular weight of 238.45 g/mol, XLogP of 4.70, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-dimethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]silane is sourced from PubChem (CID 89476029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).