About 1,2-dimethyl-5-(2-methylbutan-2-yloxy)-1,2-dihydroacenaphthylene
1,2-dimethyl-5-(2-methylbutan-2-yloxy)-1,2-dihydroacenaphthylene (PubChem CID 89476069) has the molecular formula C19H24O
and a molecular weight of 268.40 g/mol. Its IUPAC name is 1,2-dimethyl-5-(2-methylbutan-2-yloxy)-1,2-dihydroacenaphthylene.
Molecular Properties
| Compound Name | 1,2-dimethyl-5-(2-methylbutan-2-yloxy)-1,2-dihydroacenaphthylene |
| PubChem CID | 89476069 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1,2-dimethyl-5-(2-methylbutan-2-yloxy)-1,2-dihydroacenaphthylene |
| SMILES | CCC(C)(C)Oc1ccc2c3c(cccc13)C(C)C2C |
| InChI | InChI=1S/C19H24O/c1-6-19(4,5)20-17-11-10-15-13(3)12(2)14-8-7-9-16(17)18(14)15/h7-13H,6H2,1-5H3 |
| InChIKey | NDOQQFYHKXBHDB-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2-dimethyl-5-(2-methylbutan-2-yloxy)-1,2-dihydroacenaphthylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-5-(2-methylbutan-2-yloxy)-1,2-dihydroacenaphthylene?
The IUPAC name of 1,2-dimethyl-5-(2-methylbutan-2-yloxy)-1,2-dihydroacenaphthylene (CID 89476069) is 1,2-dimethyl-5-(2-methylbutan-2-yloxy)-1,2-dihydroacenaphthylene.
What is the SMILES notation for 1,2-dimethyl-5-(2-methylbutan-2-yloxy)-1,2-dihydroacenaphthylene?
The canonical SMILES for 1,2-dimethyl-5-(2-methylbutan-2-yloxy)-1,2-dihydroacenaphthylene is CCC(C)(C)Oc1ccc2c3c(cccc13)C(C)C2C.
What is the InChIKey of 1,2-dimethyl-5-(2-methylbutan-2-yloxy)-1,2-dihydroacenaphthylene?
The InChIKey is NDOQQFYHKXBHDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24O/c1-6-19(4,5)20-17-11-10-15-13(3)12(2)14-8-7-9-16(17)18(14)15/h7-13H,6H2,1-5H3.
What are the key properties of 1,2-dimethyl-5-(2-methylbutan-2-yloxy)-1,2-dihydroacenaphthylene?
1,2-dimethyl-5-(2-methylbutan-2-yloxy)-1,2-dihydroacenaphthylene has a molecular weight of 268.40 g/mol, XLogP of 5.63, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-5-(2-methylbutan-2-yloxy)-1,2-dihydroacenaphthylene is sourced from PubChem (CID 89476069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).