C21H32N2 — CID 89476074
1,3-bis[(6S)-2,4,6-trimethylcyclohexa-1,3-dien-1-yl]imidazolidine (PubChem CID 89476074) has the molecular formula C21H32N2 and a molecular weight of 312.50 g/mol. Its IUPAC name is 1,3-bis[(6S)-2,4,6-trimethylcyclohexa-1,3-dien-1-yl]imidazolidine.
| Compound Name | 1,3-bis[(6S)-2,4,6-trimethylcyclohexa-1,3-dien-1-yl]imidazolidine |
|---|---|
| PubChem CID | 89476074 |
| Molecular Formula | C21H32N2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.26 |
| IUPAC Name | 1,3-bis[(6S)-2,4,6-trimethylcyclohexa-1,3-dien-1-yl]imidazolidine |
| SMILES | CC1=CC(C)=C(N2CCN(C3=C(C)C=C(C)C[C@@H]3C)C2)[C@@H](C)C1 |
| InChI | InChI=1S/C21H32N2/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6/h9,11,17,19H,7-8,10,12-13H2,1-6H3/t17-,19-/m0/s1 |
| InChIKey | RELALRHHVHUXJU-HKUYNNGSSA-N |
| XLogP | 5.08 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |