C27H42N2 — CID 89476075
1,3-bis[(6R)-2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-yl]-2H-imidazole (PubChem CID 89476075) has the molecular formula C27H42N2 and a molecular weight of 394.65 g/mol. Its IUPAC name is 1,3-bis[(6R)-2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-yl]-2H-imidazole.
| Compound Name | 1,3-bis[(6R)-2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-yl]-2H-imidazole |
|---|---|
| PubChem CID | 89476075 |
| Molecular Formula | C27H42N2 |
| Molecular Weight | 394.65 g/mol |
| Exact Mass | 394.33 |
| IUPAC Name | 1,3-bis[(6R)-2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-yl]-2H-imidazole |
| SMILES | CC(C)C1=C(N2C=CN(C3=C(C(C)C)C=CC[C@@H]3C(C)C)C2)[C@@H](C(C)C)CC=C1 |
| InChI | InChI=1S/C27H42N2/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8/h9-11,13,15-16,18-21,23,25H,12,14,17H2,1-8H3/t23-,25-/m1/s1 |
| InChIKey | FZXWZQWEFSZRNB-ILBGXUMGSA-N |
| XLogP | 7.32 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.65 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |