About 6-[[5-(benzylamino)-1,3,4-oxadiazol-2-yl]methoxy]-1H-quinolin-2-one
6-[[5-(benzylamino)-1,3,4-oxadiazol-2-yl]methoxy]-1H-quinolin-2-one (PubChem CID 89476296) has the molecular formula C19H16N4O3
and a molecular weight of 348.36 g/mol. Its IUPAC name is 6-[[5-(benzylamino)-1,3,4-oxadiazol-2-yl]methoxy]-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 6-[[5-(benzylamino)-1,3,4-oxadiazol-2-yl]methoxy]-1H-quinolin-2-one |
| PubChem CID | 89476296 |
| Molecular Formula | C19H16N4O3 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 6-[[5-(benzylamino)-1,3,4-oxadiazol-2-yl]methoxy]-1H-quinolin-2-one |
| SMILES | O=c1ccc2cc(OCc3nnc(NCc4ccccc4)o3)ccc2[nH]1 |
| InChI | InChI=1S/C19H16N4O3/c24-17-9-6-14-10-15(7-8-16(14)21-17)25-12-18-22-23-19(26-18)20-11-13-4-2-1-3-5-13/h1-10H,11-12H2,(H,20,23)(H,21,24) |
| InChIKey | MYLOGZIMLIVYLP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[[5-(benzylamino)-1,3,4-oxadiazol-2-yl]methoxy]-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[5-(benzylamino)-1,3,4-oxadiazol-2-yl]methoxy]-1H-quinolin-2-one?
The IUPAC name of 6-[[5-(benzylamino)-1,3,4-oxadiazol-2-yl]methoxy]-1H-quinolin-2-one (CID 89476296) is 6-[[5-(benzylamino)-1,3,4-oxadiazol-2-yl]methoxy]-1H-quinolin-2-one.
What is the SMILES notation for 6-[[5-(benzylamino)-1,3,4-oxadiazol-2-yl]methoxy]-1H-quinolin-2-one?
The canonical SMILES for 6-[[5-(benzylamino)-1,3,4-oxadiazol-2-yl]methoxy]-1H-quinolin-2-one is O=c1ccc2cc(OCc3nnc(NCc4ccccc4)o3)ccc2[nH]1.
What is the InChIKey of 6-[[5-(benzylamino)-1,3,4-oxadiazol-2-yl]methoxy]-1H-quinolin-2-one?
The InChIKey is MYLOGZIMLIVYLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4O3/c24-17-9-6-14-10-15(7-8-16(14)21-17)25-12-18-22-23-19(26-18)20-11-13-4-2-1-3-5-13/h1-10H,11-12H2,(H,20,23)(H,21,24).
What are the key properties of 6-[[5-(benzylamino)-1,3,4-oxadiazol-2-yl]methoxy]-1H-quinolin-2-one?
6-[[5-(benzylamino)-1,3,4-oxadiazol-2-yl]methoxy]-1H-quinolin-2-one has a molecular weight of 348.36 g/mol, XLogP of 3.10, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[5-(benzylamino)-1,3,4-oxadiazol-2-yl]methoxy]-1H-quinolin-2-one is sourced from PubChem (CID 89476296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).