About methyl 2-acetyl-3,3-dimethylbutanoate
methyl 2-acetyl-3,3-dimethylbutanoate (PubChem CID 89476338) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is methyl 2-acetyl-3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | methyl 2-acetyl-3,3-dimethylbutanoate |
| PubChem CID | 89476338 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | methyl 2-acetyl-3,3-dimethylbutanoate |
| SMILES | COC(=O)C(C(C)=O)C(C)(C)C |
| InChI | InChI=1S/C9H16O3/c1-6(10)7(8(11)12-5)9(2,3)4/h7H,1-5H3 |
| InChIKey | ZQZMCUQDKLZCBS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-acetyl-3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-acetyl-3,3-dimethylbutanoate?
The IUPAC name of methyl 2-acetyl-3,3-dimethylbutanoate (CID 89476338) is methyl 2-acetyl-3,3-dimethylbutanoate.
What is the SMILES notation for methyl 2-acetyl-3,3-dimethylbutanoate?
The canonical SMILES for methyl 2-acetyl-3,3-dimethylbutanoate is COC(=O)C(C(C)=O)C(C)(C)C.
What is the InChIKey of methyl 2-acetyl-3,3-dimethylbutanoate?
The InChIKey is ZQZMCUQDKLZCBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c1-6(10)7(8(11)12-5)9(2,3)4/h7H,1-5H3.
What are the key properties of methyl 2-acetyl-3,3-dimethylbutanoate?
methyl 2-acetyl-3,3-dimethylbutanoate has a molecular weight of 172.22 g/mol, XLogP of 1.41, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetyl-3,3-dimethylbutanoate is sourced from PubChem (CID 89476338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).