C24H25F13O9 — CID 89476401
[2,2,3,3-tetrafluoro-3-[2-fluoro-2,3-bis[(2,2,3,3-tetrafluoro-5-methyl-4-oxohex-5-enyl)peroxy]propoxy]propyl] 2-methylprop-2-enoate (PubChem CID 89476401) has the molecular formula C24H25F13O9 and a molecular weight of 704.43 g/mol. Its IUPAC name is [2,2,3,3-tetrafluoro-3-[2-fluoro-2,3-bis[(2,2,3,3-tetrafluoro-5-methyl-4-oxohex-5-enyl)peroxy]propoxy]propyl] 2-methylprop-2-enoate.
| Compound Name | [2,2,3,3-tetrafluoro-3-[2-fluoro-2,3-bis[(2,2,3,3-tetrafluoro-5-methyl-4-oxohex-5-enyl)peroxy]propoxy]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89476401 |
| Molecular Formula | C24H25F13O9 |
| Molecular Weight | 704.43 g/mol |
| Exact Mass | 704.13 |
| IUPAC Name | [2,2,3,3-tetrafluoro-3-[2-fluoro-2,3-bis[(2,2,3,3-tetrafluoro-5-methyl-4-oxohex-5-enyl)peroxy]propoxy]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(F)(F)C(F)(F)OCC(F)(COOCC(F)(F)C(F)(F)C(=O)C(=C)C)OOCC(F)(F)C(F)(F)C(=O)C(=C)C |
| InChI | InChI=1S/C24H25F13O9/c1-12(2)15(38)22(32,33)19(26,27)10-44-43-8-18(25,46-45-11-20(28,29)23(34,35)16(39)13(3)4)7-42-24(36,37)21(30,31)9-41-17(40)14(5)6/h1,3,5,7-11H2,2,4,6H3 |
| InChIKey | WBNCJORFSWHGAT-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.43 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|