C14H19F11O2 — CID 89476456
2-[difluoro-(1,1,1,2-tetrafluoro-2-methoxy-3-methylpentan-3-yl)oxymethyl]-1,1,1,2,3-pentafluoro-3-methylpentane (PubChem CID 89476456) has the molecular formula C14H19F11O2 and a molecular weight of 428.28 g/mol. Its IUPAC name is 2-[difluoro-(1,1,1,2-tetrafluoro-2-methoxy-3-methylpentan-3-yl)oxymethyl]-1,1,1,2,3-pentafluoro-3-methylpentane.
| Compound Name | 2-[difluoro-(1,1,1,2-tetrafluoro-2-methoxy-3-methylpentan-3-yl)oxymethyl]-1,1,1,2,3-pentafluoro-3-methylpentane |
|---|---|
| PubChem CID | 89476456 |
| Molecular Formula | C14H19F11O2 |
| Molecular Weight | 428.28 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 2-[difluoro-(1,1,1,2-tetrafluoro-2-methoxy-3-methylpentan-3-yl)oxymethyl]-1,1,1,2,3-pentafluoro-3-methylpentane |
| SMILES | CCC(C)(F)C(F)(C(F)(F)F)C(F)(F)OC(C)(CC)C(F)(OC)C(F)(F)F |
| InChI | InChI=1S/C14H19F11O2/c1-6-8(3,15)10(16,12(18,19)20)14(24,25)27-9(4,7-2)11(17,26-5)13(21,22)23/h6-7H2,1-5H3 |
| InChIKey | XJBPPLNWQMSBMU-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.28 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |