C31H26BrNO2 — CID 89476492
6-(2-bromopropan-2-yl)-2,12,18-trimethyl-18-azaheptacyclo[14.6.2.12,12.13,7.013,23.020,24.011,26]hexacosa-1(22),3(26),4,6,8,10,13(23),14,16(24),20-decaene-17,19-dione (PubChem CID 89476492) has the molecular formula C31H26BrNO2 and a molecular weight of 524.46 g/mol. Its IUPAC name is 6-(2-bromopropan-2-yl)-2,12,18-trimethyl-18-azaheptacyclo[14.6.2.12,12.13,7.013,23.020,24.011,26]hexacosa-1(22),3(26),4,6,8,10,13(23),14,16(24),20-decaene-17,19-dione.
| Compound Name | 6-(2-bromopropan-2-yl)-2,12,18-trimethyl-18-azaheptacyclo[14.6.2.12,12.13,7.013,23.020,24.011,26]hexacosa-1(22),3(26),4,6,8,10,13(23),14,16(24),20-decaene-17,19-dione |
|---|---|
| PubChem CID | 89476492 |
| Molecular Formula | C31H26BrNO2 |
| Molecular Weight | 524.46 g/mol |
| Exact Mass | 523.11 |
| IUPAC Name | 6-(2-bromopropan-2-yl)-2,12,18-trimethyl-18-azaheptacyclo[14.6.2.12,12.13,7.013,23.020,24.011,26]hexacosa-1(22),3(26),4,6,8,10,13(23),14,16(24),20-decaene-17,19-dione |
| SMILES | CN1C(=O)c2ccc3c4c(ccc(c24)C1=O)C1(C)CC3(C)c2cccc3c(C(C)(C)Br)ccc1c23 |
| InChI | InChI=1S/C31H26BrNO2/c1-29(2,32)19-13-14-21-25-16(19)7-6-8-20(25)30(3)15-31(21,4)23-12-10-18-24-17(9-11-22(30)26(23)24)27(34)33(5)28(18)35/h6-14H,15H2,1-5H3 |
| InChIKey | MGRYZPSLLSOOHT-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.46 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|