C24H23F3N4O3 — CID 89476576
(3S)-5-oxo-N-[1-phenyl-5-[3-(4,4,4-trifluorobutoxy)phenyl]pyrazol-3-yl]pyrrolidine-3-carboxamide (PubChem CID 89476576) has the molecular formula C24H23F3N4O3 and a molecular weight of 472.47 g/mol. Its IUPAC name is (3S)-5-oxo-N-[1-phenyl-5-[3-(4,4,4-trifluorobutoxy)phenyl]pyrazol-3-yl]pyrrolidine-3-carboxamide.
| Compound Name | (3S)-5-oxo-N-[1-phenyl-5-[3-(4,4,4-trifluorobutoxy)phenyl]pyrazol-3-yl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 89476576 |
| Molecular Formula | C24H23F3N4O3 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | (3S)-5-oxo-N-[1-phenyl-5-[3-(4,4,4-trifluorobutoxy)phenyl]pyrazol-3-yl]pyrrolidine-3-carboxamide |
| SMILES | O=C1C[C@H](C(=O)Nc2cc(-c3cccc(OCCCC(F)(F)F)c3)n(-c3ccccc3)n2)CN1 |
| InChI | InChI=1S/C24H23F3N4O3/c25-24(26,27)10-5-11-34-19-9-4-6-16(12-19)20-14-21(29-23(33)17-13-22(32)28-15-17)30-31(20)18-7-2-1-3-8-18/h1-4,6-9,12,14,17H,5,10-11,13,15H2,(H,28,32)(H,29,30,33)/t17-/m0/s1 |
| InChIKey | MBAUIHJKPCDGDQ-KRWDZBQOSA-N |
| XLogP | 4.34 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|