C14H11N3OS — CID 894766
5-(phenylsulfanylmethyl)-3-pyridin-4-yl-1,2,4-oxadiazole (PubChem CID 894766) has the molecular formula C14H11N3OS and a molecular weight of 269.33 g/mol. Its IUPAC name is 5-(phenylsulfanylmethyl)-3-pyridin-4-yl-1,2,4-oxadiazole.
| Compound Name | 5-(phenylsulfanylmethyl)-3-pyridin-4-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 894766 |
| Molecular Formula | C14H11N3OS |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 5-(phenylsulfanylmethyl)-3-pyridin-4-yl-1,2,4-oxadiazole |
| SMILES | c1ccc(SCc2nc(-c3ccncc3)no2)cc1 |
| InChI | InChI=1S/C14H11N3OS/c1-2-4-12(5-3-1)19-10-13-16-14(17-18-13)11-6-8-15-9-7-11/h1-9H,10H2 |
| InChIKey | WVSOTBSXFZKNRX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |