C11H11ClN8 — CID 89477439
1-(12-chloro-2,3,4,5,8,10-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)-N-methylazetidin-3-amine (PubChem CID 89477439) has the molecular formula C11H11ClN8 and a molecular weight of 290.72 g/mol. Its IUPAC name is 1-(12-chloro-2,3,4,5,8,10-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)-N-methylazetidin-3-amine.
| Compound Name | 1-(12-chloro-2,3,4,5,8,10-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)-N-methylazetidin-3-amine |
|---|---|
| PubChem CID | 89477439 |
| Molecular Formula | C11H11ClN8 |
| Molecular Weight | 290.72 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 1-(12-chloro-2,3,4,5,8,10-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)-N-methylazetidin-3-amine |
| SMILES | CNC1CN(c2nc3ncc(Cl)cc3n3nnnc23)C1 |
| InChI | InChI=1S/C11H11ClN8/c1-13-7-4-19(5-7)10-11-16-17-18-20(11)8-2-6(12)3-14-9(8)15-10/h2-3,7,13H,4-5H2,1H3 |
| InChIKey | GDZLFSXESWAMER-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 84.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.72 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |