C16H13FN2OS — CID 89477926
1-[5-(4-fluorophenyl)-1,2-thiazol-3-yl]-2-pyridin-4-ylethanol (PubChem CID 89477926) has the molecular formula C16H13FN2OS and a molecular weight of 300.36 g/mol. Its IUPAC name is 1-[5-(4-fluorophenyl)-1,2-thiazol-3-yl]-2-pyridin-4-ylethanol.
| Compound Name | 1-[5-(4-fluorophenyl)-1,2-thiazol-3-yl]-2-pyridin-4-ylethanol |
|---|---|
| PubChem CID | 89477926 |
| Molecular Formula | C16H13FN2OS |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 1-[5-(4-fluorophenyl)-1,2-thiazol-3-yl]-2-pyridin-4-ylethanol |
| SMILES | OC(Cc1ccncc1)c1cc(-c2ccc(F)cc2)sn1 |
| InChI | InChI=1S/C16H13FN2OS/c17-13-3-1-12(2-4-13)16-10-14(19-21-16)15(20)9-11-5-7-18-8-6-11/h1-8,10,15,20H,9H2 |
| InChIKey | SSIUYONVBPOOIK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |