C19H16F2N6O2S3 — CID 89478104
aminothiourea;3-(1,3-benzodioxol-5-ylmethylsulfanyl)-5-(2,4-difluorophenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazole (PubChem CID 89478104) has the molecular formula C19H16F2N6O2S3 and a molecular weight of 494.57 g/mol. Its IUPAC name is aminothiourea;3-(1,3-benzodioxol-5-ylmethylsulfanyl)-5-(2,4-difluorophenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazole.
| Compound Name | aminothiourea;3-(1,3-benzodioxol-5-ylmethylsulfanyl)-5-(2,4-difluorophenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazole |
|---|---|
| PubChem CID | 89478104 |
| Molecular Formula | C19H16F2N6O2S3 |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | aminothiourea;3-(1,3-benzodioxol-5-ylmethylsulfanyl)-5-(2,4-difluorophenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazole |
| SMILES | Fc1ccc(-c2csc3nnc(SCc4ccc5c(c4)OCO5)n23)c(F)c1.NNC(N)=S |
| InChI | InChI=1S/C18H11F2N3O2S2.CH5N3S/c19-11-2-3-12(13(20)6-11)14-8-27-18-22-21-17(23(14)18)26-7-10-1-4-15-16(5-10)25-9-24-15;2-1(5)4-3/h1-6,8H,7,9H2;3H2,(H3,2,4,5) |
| InChIKey | BZLAPXIBUKXMSJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 112.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|