C30H34O5 — CID 89478669
3-[2-[2-[4-[2-(2-carboxyethenyl)phenyl]-2,2,5,5-tetramethylhex-3-en-3-yl]oxyethenyl]phenyl]prop-2-enoic acid (PubChem CID 89478669) has the molecular formula C30H34O5 and a molecular weight of 474.60 g/mol. Its IUPAC name is 3-[2-[2-[4-[2-(2-carboxyethenyl)phenyl]-2,2,5,5-tetramethylhex-3-en-3-yl]oxyethenyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[2-[2-[4-[2-(2-carboxyethenyl)phenyl]-2,2,5,5-tetramethylhex-3-en-3-yl]oxyethenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 89478669 |
| Molecular Formula | C30H34O5 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 3-[2-[2-[4-[2-(2-carboxyethenyl)phenyl]-2,2,5,5-tetramethylhex-3-en-3-yl]oxyethenyl]phenyl]prop-2-enoic acid |
| SMILES | CC(C)(C)C(OC=Cc1ccccc1C=CC(=O)O)=C(c1ccccc1C=CC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C30H34O5/c1-29(2,3)27(24-14-10-9-13-23(24)16-18-26(33)34)28(30(4,5)6)35-20-19-22-12-8-7-11-21(22)15-17-25(31)32/h7-20H,1-6H3,(H,31,32)(H,33,34) |
| InChIKey | KDYAMXKNNLRSJQ-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|