About 3-(2-methoxyethoxy)-7-(4-methyl-3-pyridinyl)-1,2-benzoxazole
3-(2-methoxyethoxy)-7-(4-methyl-3-pyridinyl)-1,2-benzoxazole (PubChem CID 89478768) has the molecular formula C16H16N2O3
and a molecular weight of 284.31 g/mol. Its IUPAC name is 3-(2-methoxyethoxy)-7-(4-methyl-3-pyridinyl)-1,2-benzoxazole.
Molecular Properties
| Compound Name | 3-(2-methoxyethoxy)-7-(4-methyl-3-pyridinyl)-1,2-benzoxazole |
| PubChem CID | 89478768 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 3-(2-methoxyethoxy)-7-(4-methyl-3-pyridinyl)-1,2-benzoxazole |
| SMILES | COCCOc1noc2c(-c3cnccc3C)cccc12 |
| InChI | InChI=1S/C16H16N2O3/c1-11-6-7-17-10-14(11)12-4-3-5-13-15(12)21-18-16(13)20-9-8-19-2/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | BETXZPZNBFOFRZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methoxyethoxy)-7-(4-methyl-3-pyridinyl)-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methoxyethoxy)-7-(4-methyl-3-pyridinyl)-1,2-benzoxazole?
The IUPAC name of 3-(2-methoxyethoxy)-7-(4-methyl-3-pyridinyl)-1,2-benzoxazole (CID 89478768) is 3-(2-methoxyethoxy)-7-(4-methyl-3-pyridinyl)-1,2-benzoxazole.
What is the SMILES notation for 3-(2-methoxyethoxy)-7-(4-methyl-3-pyridinyl)-1,2-benzoxazole?
The canonical SMILES for 3-(2-methoxyethoxy)-7-(4-methyl-3-pyridinyl)-1,2-benzoxazole is COCCOc1noc2c(-c3cnccc3C)cccc12.
What is the InChIKey of 3-(2-methoxyethoxy)-7-(4-methyl-3-pyridinyl)-1,2-benzoxazole?
The InChIKey is BETXZPZNBFOFRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O3/c1-11-6-7-17-10-14(11)12-4-3-5-13-15(12)21-18-16(13)20-9-8-19-2/h3-7,10H,8-9H2,1-2H3.
What are the key properties of 3-(2-methoxyethoxy)-7-(4-methyl-3-pyridinyl)-1,2-benzoxazole?
3-(2-methoxyethoxy)-7-(4-methyl-3-pyridinyl)-1,2-benzoxazole has a molecular weight of 284.31 g/mol, XLogP of 3.22, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methoxyethoxy)-7-(4-methyl-3-pyridinyl)-1,2-benzoxazole is sourced from PubChem (CID 89478768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).