About 7-bromo-3-(3,3,3-trifluoropropyl)-1,2-benzoxazole
7-bromo-3-(3,3,3-trifluoropropyl)-1,2-benzoxazole (PubChem CID 89479111) has the molecular formula C10H7BrF3NO
and a molecular weight of 294.07 g/mol. Its IUPAC name is 7-bromo-3-(3,3,3-trifluoropropyl)-1,2-benzoxazole.
Molecular Properties
| Compound Name | 7-bromo-3-(3,3,3-trifluoropropyl)-1,2-benzoxazole |
| PubChem CID | 89479111 |
| Molecular Formula | C10H7BrF3NO |
| Molecular Weight | 294.07 g/mol |
| Exact Mass | 292.97 |
| IUPAC Name | 7-bromo-3-(3,3,3-trifluoropropyl)-1,2-benzoxazole |
| SMILES | FC(F)(F)CCc1noc2c(Br)cccc12 |
| InChI | InChI=1S/C10H7BrF3NO/c11-7-3-1-2-6-8(15-16-9(6)7)4-5-10(12,13)14/h1-3H,4-5H2 |
| InChIKey | DWBWSKUJEQZBKJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.07 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-3-(3,3,3-trifluoropropyl)-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-3-(3,3,3-trifluoropropyl)-1,2-benzoxazole?
The IUPAC name of 7-bromo-3-(3,3,3-trifluoropropyl)-1,2-benzoxazole (CID 89479111) is 7-bromo-3-(3,3,3-trifluoropropyl)-1,2-benzoxazole.
What is the SMILES notation for 7-bromo-3-(3,3,3-trifluoropropyl)-1,2-benzoxazole?
The canonical SMILES for 7-bromo-3-(3,3,3-trifluoropropyl)-1,2-benzoxazole is FC(F)(F)CCc1noc2c(Br)cccc12.
What is the InChIKey of 7-bromo-3-(3,3,3-trifluoropropyl)-1,2-benzoxazole?
The InChIKey is DWBWSKUJEQZBKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrF3NO/c11-7-3-1-2-6-8(15-16-9(6)7)4-5-10(12,13)14/h1-3H,4-5H2.
What are the key properties of 7-bromo-3-(3,3,3-trifluoropropyl)-1,2-benzoxazole?
7-bromo-3-(3,3,3-trifluoropropyl)-1,2-benzoxazole has a molecular weight of 294.07 g/mol, XLogP of 4.09, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-3-(3,3,3-trifluoropropyl)-1,2-benzoxazole is sourced from PubChem (CID 89479111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).