About tert-butyl N-[(4R,5R)-4-(4-amino-1-methylpyrazol-5-yl)-5-fluoroazepan-4-yl]carbamate
tert-butyl N-[(4R,5R)-4-(4-amino-1-methylpyrazol-5-yl)-5-fluoroazepan-4-yl]carbamate (PubChem CID 89479403) has the molecular formula C15H26FN5O2
and a molecular weight of 327.40 g/mol. Its IUPAC name is tert-butyl N-[(4R,5R)-4-(4-amino-1-methylpyrazol-5-yl)-5-fluoroazepan-4-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(4R,5R)-4-(4-amino-1-methylpyrazol-5-yl)-5-fluoroazepan-4-yl]carbamate |
| PubChem CID | 89479403 |
| Molecular Formula | C15H26FN5O2 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | tert-butyl N-[(4R,5R)-4-(4-amino-1-methylpyrazol-5-yl)-5-fluoroazepan-4-yl]carbamate |
| SMILES | Cn1ncc(N)c1[C@]1(NC(=O)OC(C)(C)C)CCNCC[C@H]1F |
| InChI | InChI=1S/C15H26FN5O2/c1-14(2,3)23-13(22)20-15(6-8-18-7-5-11(15)16)12-10(17)9-19-21(12)4/h9,11,18H,5-8,17H2,1-4H3,(H,20,22)/t11-,15+/m1/s1 |
| InChIKey | PGCWPLWHCHCOCL-ABAIWWIYSA-N |
| XLogP | 1.44 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-[(4R,5R)-4-(4-amino-1-methylpyrazol-5-yl)-5-fluoroazepan-4-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(4R,5R)-4-(4-amino-1-methylpyrazol-5-yl)-5-fluoroazepan-4-yl]carbamate?
The IUPAC name of tert-butyl N-[(4R,5R)-4-(4-amino-1-methylpyrazol-5-yl)-5-fluoroazepan-4-yl]carbamate (CID 89479403) is tert-butyl N-[(4R,5R)-4-(4-amino-1-methylpyrazol-5-yl)-5-fluoroazepan-4-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(4R,5R)-4-(4-amino-1-methylpyrazol-5-yl)-5-fluoroazepan-4-yl]carbamate?
The canonical SMILES for tert-butyl N-[(4R,5R)-4-(4-amino-1-methylpyrazol-5-yl)-5-fluoroazepan-4-yl]carbamate is Cn1ncc(N)c1[C@]1(NC(=O)OC(C)(C)C)CCNCC[C@H]1F.
What is the InChIKey of tert-butyl N-[(4R,5R)-4-(4-amino-1-methylpyrazol-5-yl)-5-fluoroazepan-4-yl]carbamate?
The InChIKey is PGCWPLWHCHCOCL-ABAIWWIYSA-N. The full InChI is InChI=1S/C15H26FN5O2/c1-14(2,3)23-13(22)20-15(6-8-18-7-5-11(15)16)12-10(17)9-19-21(12)4/h9,11,18H,5-8,17H2,1-4H3,(H,20,22)/t11-,15+/m1/s1.
What are the key properties of tert-butyl N-[(4R,5R)-4-(4-amino-1-methylpyrazol-5-yl)-5-fluoroazepan-4-yl]carbamate?
tert-butyl N-[(4R,5R)-4-(4-amino-1-methylpyrazol-5-yl)-5-fluoroazepan-4-yl]carbamate has a molecular weight of 327.40 g/mol, XLogP of 1.44, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(4R,5R)-4-(4-amino-1-methylpyrazol-5-yl)-5-fluoroazepan-4-yl]carbamate is sourced from PubChem (CID 89479403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).