C13H16F5N5O3 — CID 89479511
N-[1-[3-(difluoromethyl)-1-methyl-4-nitropyrazol-5-yl]azepan-4-yl]-2,2,2-trifluoroacetamide (PubChem CID 89479511) has the molecular formula C13H16F5N5O3 and a molecular weight of 385.29 g/mol. Its IUPAC name is N-[1-[3-(difluoromethyl)-1-methyl-4-nitropyrazol-5-yl]azepan-4-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[1-[3-(difluoromethyl)-1-methyl-4-nitropyrazol-5-yl]azepan-4-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 89479511 |
| Molecular Formula | C13H16F5N5O3 |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N-[1-[3-(difluoromethyl)-1-methyl-4-nitropyrazol-5-yl]azepan-4-yl]-2,2,2-trifluoroacetamide |
| SMILES | Cn1nc(C(F)F)c([N+](=O)[O-])c1N1CCCC(NC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H16F5N5O3/c1-21-11(9(23(25)26)8(20-21)10(14)15)22-5-2-3-7(4-6-22)19-12(24)13(16,17)18/h7,10H,2-6H2,1H3,(H,19,24) |
| InChIKey | BZJQUHXXXLFWCP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|