About ruthenium(3+);trioxido-phenyl-(trifluoromethyl)-λ5-phosphane
ruthenium(3+);trioxido-phenyl-(trifluoromethyl)-λ5-phosphane (PubChem CID 89480526) has the molecular formula C7H5F3O3PRu
and a molecular weight of 326.15 g/mol. Its IUPAC name is ruthenium(3+);trioxido-phenyl-(trifluoromethyl)-λ5-phosphane.
Molecular Properties
| Compound Name | ruthenium(3+);trioxido-phenyl-(trifluoromethyl)-λ5-phosphane |
| PubChem CID | 89480526 |
| Molecular Formula | C7H5F3O3PRu |
| Molecular Weight | 326.15 g/mol |
| Exact Mass | 326.90 |
| IUPAC Name | ruthenium(3+);trioxido-phenyl-(trifluoromethyl)-λ5-phosphane |
| SMILES | [O-]P([O-])([O-])(c1ccccc1)C(F)(F)F.[Ru+3] |
| InChI | InChI=1S/C7H5F3O3P.Ru/c8-7(9,10)14(11,12,13)6-4-2-1-3-5-6;/h1-5H;/q-3;+3 |
| InChIKey | SKYSZTGCXPTERQ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.15 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ruthenium(3+);trioxido-phenyl-(trifluoromethyl)-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ruthenium(3+);trioxido-phenyl-(trifluoromethyl)-λ5-phosphane?
The IUPAC name of ruthenium(3+);trioxido-phenyl-(trifluoromethyl)-λ5-phosphane (CID 89480526) is ruthenium(3+);trioxido-phenyl-(trifluoromethyl)-λ5-phosphane.
What is the SMILES notation for ruthenium(3+);trioxido-phenyl-(trifluoromethyl)-λ5-phosphane?
The canonical SMILES for ruthenium(3+);trioxido-phenyl-(trifluoromethyl)-λ5-phosphane is [O-]P([O-])([O-])(c1ccccc1)C(F)(F)F.[Ru+3].
What is the InChIKey of ruthenium(3+);trioxido-phenyl-(trifluoromethyl)-λ5-phosphane?
The InChIKey is SKYSZTGCXPTERQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F3O3P.Ru/c8-7(9,10)14(11,12,13)6-4-2-1-3-5-6;/h1-5H;/q-3;+3.
What are the key properties of ruthenium(3+);trioxido-phenyl-(trifluoromethyl)-λ5-phosphane?
ruthenium(3+);trioxido-phenyl-(trifluoromethyl)-λ5-phosphane has a molecular weight of 326.15 g/mol, XLogP of -0.79, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ruthenium(3+);trioxido-phenyl-(trifluoromethyl)-λ5-phosphane is sourced from PubChem (CID 89480526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).