About ruthenium;trihydroxy-methoxy-phenyl-λ5-phosphane
ruthenium;trihydroxy-methoxy-phenyl-λ5-phosphane (PubChem CID 89480558) has the molecular formula C7H11O4PRu
and a molecular weight of 291.21 g/mol. Its IUPAC name is ruthenium;trihydroxy-methoxy-phenyl-λ5-phosphane.
Molecular Properties
| Compound Name | ruthenium;trihydroxy-methoxy-phenyl-λ5-phosphane |
| PubChem CID | 89480558 |
| Molecular Formula | C7H11O4PRu |
| Molecular Weight | 291.21 g/mol |
| Exact Mass | 291.94 |
| IUPAC Name | ruthenium;trihydroxy-methoxy-phenyl-λ5-phosphane |
| SMILES | COP(O)(O)(O)c1ccccc1.[Ru] |
| InChI | InChI=1S/C7H11O4P.Ru/c1-11-12(8,9,10)7-5-3-2-4-6-7;/h2-6,8-10H,1H3; |
| InChIKey | QBTZROUMGYQAQJ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.21 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ruthenium;trihydroxy-methoxy-phenyl-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ruthenium;trihydroxy-methoxy-phenyl-λ5-phosphane?
The IUPAC name of ruthenium;trihydroxy-methoxy-phenyl-λ5-phosphane (CID 89480558) is ruthenium;trihydroxy-methoxy-phenyl-λ5-phosphane.
What is the SMILES notation for ruthenium;trihydroxy-methoxy-phenyl-λ5-phosphane?
The canonical SMILES for ruthenium;trihydroxy-methoxy-phenyl-λ5-phosphane is COP(O)(O)(O)c1ccccc1.[Ru].
What is the InChIKey of ruthenium;trihydroxy-methoxy-phenyl-λ5-phosphane?
The InChIKey is QBTZROUMGYQAQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11O4P.Ru/c1-11-12(8,9,10)7-5-3-2-4-6-7;/h2-6,8-10H,1H3;.
What are the key properties of ruthenium;trihydroxy-methoxy-phenyl-λ5-phosphane?
ruthenium;trihydroxy-methoxy-phenyl-λ5-phosphane has a molecular weight of 291.21 g/mol, XLogP of 0.15, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ruthenium;trihydroxy-methoxy-phenyl-λ5-phosphane is sourced from PubChem (CID 89480558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).