About 7-bromo-3-(1,3-thiazol-2-yl)-1,2-benzoxazole
7-bromo-3-(1,3-thiazol-2-yl)-1,2-benzoxazole (PubChem CID 89480573) has the molecular formula C10H5BrN2OS
and a molecular weight of 281.13 g/mol. Its IUPAC name is 7-bromo-3-(1,3-thiazol-2-yl)-1,2-benzoxazole.
Molecular Properties
| Compound Name | 7-bromo-3-(1,3-thiazol-2-yl)-1,2-benzoxazole |
| PubChem CID | 89480573 |
| Molecular Formula | C10H5BrN2OS |
| Molecular Weight | 281.13 g/mol |
| Exact Mass | 279.93 |
| IUPAC Name | 7-bromo-3-(1,3-thiazol-2-yl)-1,2-benzoxazole |
| SMILES | Brc1cccc2c(-c3nccs3)noc12 |
| InChI | InChI=1S/C10H5BrN2OS/c11-7-3-1-2-6-8(13-14-9(6)7)10-12-4-5-15-10/h1-5H |
| InChIKey | CUQJQSWKQGMWCU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.13 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-bromo-3-(1,3-thiazol-2-yl)-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-3-(1,3-thiazol-2-yl)-1,2-benzoxazole?
The IUPAC name of 7-bromo-3-(1,3-thiazol-2-yl)-1,2-benzoxazole (CID 89480573) is 7-bromo-3-(1,3-thiazol-2-yl)-1,2-benzoxazole.
What is the SMILES notation for 7-bromo-3-(1,3-thiazol-2-yl)-1,2-benzoxazole?
The canonical SMILES for 7-bromo-3-(1,3-thiazol-2-yl)-1,2-benzoxazole is Brc1cccc2c(-c3nccs3)noc12.
What is the InChIKey of 7-bromo-3-(1,3-thiazol-2-yl)-1,2-benzoxazole?
The InChIKey is CUQJQSWKQGMWCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5BrN2OS/c11-7-3-1-2-6-8(13-14-9(6)7)10-12-4-5-15-10/h1-5H.
What are the key properties of 7-bromo-3-(1,3-thiazol-2-yl)-1,2-benzoxazole?
7-bromo-3-(1,3-thiazol-2-yl)-1,2-benzoxazole has a molecular weight of 281.13 g/mol, XLogP of 3.71, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-3-(1,3-thiazol-2-yl)-1,2-benzoxazole is sourced from PubChem (CID 89480573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).