C22H21F3N2O3 — CID 89480905
ethyl 4-[4-(3-cyanophenyl)phenoxy]-2-(trifluoromethyl)piperidine-1-carboxylate (PubChem CID 89480905) has the molecular formula C22H21F3N2O3 and a molecular weight of 418.42 g/mol. Its IUPAC name is ethyl 4-[4-(3-cyanophenyl)phenoxy]-2-(trifluoromethyl)piperidine-1-carboxylate.
| Compound Name | ethyl 4-[4-(3-cyanophenyl)phenoxy]-2-(trifluoromethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89480905 |
| Molecular Formula | C22H21F3N2O3 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | ethyl 4-[4-(3-cyanophenyl)phenoxy]-2-(trifluoromethyl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Oc2ccc(-c3cccc(C#N)c3)cc2)CC1C(F)(F)F |
| InChI | InChI=1S/C22H21F3N2O3/c1-2-29-21(28)27-11-10-19(13-20(27)22(23,24)25)30-18-8-6-16(7-9-18)17-5-3-4-15(12-17)14-26/h3-9,12,19-20H,2,10-11,13H2,1H3 |
| InChIKey | SCWQOAOZGYDYIJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |