C16H19F6N5O3 — CID 89480974
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[2-[(4-carbamoylpyrimidin-2-yl)amino]ethyl]piperidine-1-carboxylate (PubChem CID 89480974) has the molecular formula C16H19F6N5O3 and a molecular weight of 443.35 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[2-[(4-carbamoylpyrimidin-2-yl)amino]ethyl]piperidine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[2-[(4-carbamoylpyrimidin-2-yl)amino]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89480974 |
| Molecular Formula | C16H19F6N5O3 |
| Molecular Weight | 443.35 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[2-[(4-carbamoylpyrimidin-2-yl)amino]ethyl]piperidine-1-carboxylate |
| SMILES | NC(=O)c1ccnc(NCCC2CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C16H19F6N5O3/c17-15(18,19)12(16(20,21)22)30-14(29)27-7-3-9(4-8-27)1-5-24-13-25-6-2-10(26-13)11(23)28/h2,6,9,12H,1,3-5,7-8H2,(H2,23,28)(H,24,25,26) |
| InChIKey | ZCYCKGTYUYVPGC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |