C27H31Cl2NO4 — CID 89481438
2-[5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[4-(cyclopropylmethoxy)butan-2-yl]-2-oxopiperidin-3-yl]acetic acid (PubChem CID 89481438) has the molecular formula C27H31Cl2NO4 and a molecular weight of 504.45 g/mol. Its IUPAC name is 2-[5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[4-(cyclopropylmethoxy)butan-2-yl]-2-oxopiperidin-3-yl]acetic acid.
| Compound Name | 2-[5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[4-(cyclopropylmethoxy)butan-2-yl]-2-oxopiperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 89481438 |
| Molecular Formula | C27H31Cl2NO4 |
| Molecular Weight | 504.45 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 2-[5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[4-(cyclopropylmethoxy)butan-2-yl]-2-oxopiperidin-3-yl]acetic acid |
| SMILES | CC(CCOCC1CC1)N1C(=O)C(CC(=O)O)CC(c2cccc(Cl)c2)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H31Cl2NO4/c1-17(11-12-34-16-18-5-6-18)30-26(19-7-9-22(28)10-8-19)24(20-3-2-4-23(29)13-20)14-21(27(30)33)15-25(31)32/h2-4,7-10,13,17-18,21,24,26H,5-6,11-12,14-16H2,1H3,(H,31,32) |
| InChIKey | HUCRKIOAIPAORE-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.45 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|