C26H28Cl2F3NO4 — CID 89481593
2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxo-1-[(3S)-1,1,3-trifluoro-2-hydroxy-2-methylpentan-3-yl]piperidin-3-yl]acetic acid (PubChem CID 89481593) has the molecular formula C26H28Cl2F3NO4 and a molecular weight of 546.41 g/mol. Its IUPAC name is 2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxo-1-[(3S)-1,1,3-trifluoro-2-hydroxy-2-methylpentan-3-yl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxo-1-[(3S)-1,1,3-trifluoro-2-hydroxy-2-methylpentan-3-yl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 89481593 |
| Molecular Formula | C26H28Cl2F3NO4 |
| Molecular Weight | 546.41 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | 2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxo-1-[(3S)-1,1,3-trifluoro-2-hydroxy-2-methylpentan-3-yl]piperidin-3-yl]acetic acid |
| SMILES | CC[C@@](F)(N1C(=O)[C@@](C)(CC(=O)O)C[C@H](c2cccc(Cl)c2)[C@H]1c1ccc(Cl)cc1)C(C)(O)C(F)F |
| InChI | InChI=1S/C26H28Cl2F3NO4/c1-4-26(31,25(3,36)22(29)30)32-21(15-8-10-17(27)11-9-15)19(16-6-5-7-18(28)12-16)13-24(2,23(32)35)14-20(33)34/h5-12,19,21-22,36H,4,13-14H2,1-3H3,(H,33,34)/t19-,21-,24-,25?,26-/m1/s1 |
| InChIKey | GISCWCIYFPANBW-KFUVMBLFSA-N |
| XLogP | 6.62 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.41 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|