C32H35Cl2NO3S — CID 89481749
methyl 2-[1-[(2S)-4-benzylsulfanylbutan-2-yl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxopiperidin-3-yl]acetate (PubChem CID 89481749) has the molecular formula C32H35Cl2NO3S and a molecular weight of 584.61 g/mol. Its IUPAC name is methyl 2-[1-[(2S)-4-benzylsulfanylbutan-2-yl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxopiperidin-3-yl]acetate.
| Compound Name | methyl 2-[1-[(2S)-4-benzylsulfanylbutan-2-yl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxopiperidin-3-yl]acetate |
|---|---|
| PubChem CID | 89481749 |
| Molecular Formula | C32H35Cl2NO3S |
| Molecular Weight | 584.61 g/mol |
| Exact Mass | 583.17 |
| IUPAC Name | methyl 2-[1-[(2S)-4-benzylsulfanylbutan-2-yl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxopiperidin-3-yl]acetate |
| SMILES | COC(=O)CC1(C)CC(c2cccc(Cl)c2)C(c2ccc(Cl)cc2)N([C@@H](C)CCSCc2ccccc2)C1=O |
| InChI | InChI=1S/C32H35Cl2NO3S/c1-22(16-17-39-21-23-8-5-4-6-9-23)35-30(24-12-14-26(33)15-13-24)28(25-10-7-11-27(34)18-25)19-32(2,31(35)37)20-29(36)38-3/h4-15,18,22,28,30H,16-17,19-21H2,1-3H3/t22-,28?,30?,32?/m0/s1 |
| InChIKey | DOZSIXXOPFIKTG-DVRYVFIDSA-N |
| XLogP | 8.33 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.61 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|