About 4-[(3,5-dimethoxyphenyl)-methoxymethyl]-7-methoxyisoquinoline;hydrochloride
4-[(3,5-dimethoxyphenyl)-methoxymethyl]-7-methoxyisoquinoline;hydrochloride (PubChem CID 89481927) has the molecular formula C20H22ClNO4
and a molecular weight of 375.85 g/mol. Its IUPAC name is 4-[(3,5-dimethoxyphenyl)-methoxymethyl]-7-methoxyisoquinoline;hydrochloride.
Molecular Properties
| Compound Name | 4-[(3,5-dimethoxyphenyl)-methoxymethyl]-7-methoxyisoquinoline;hydrochloride |
| PubChem CID | 89481927 |
| Molecular Formula | C20H22ClNO4 |
| Molecular Weight | 375.85 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 4-[(3,5-dimethoxyphenyl)-methoxymethyl]-7-methoxyisoquinoline;hydrochloride |
| SMILES | COc1cc(OC)cc(C(OC)c2cncc3cc(OC)ccc23)c1.Cl |
| InChI | InChI=1S/C20H21NO4.ClH/c1-22-15-5-6-18-14(9-15)11-21-12-19(18)20(25-4)13-7-16(23-2)10-17(8-13)24-3;/h5-12,20H,1-4H3;1H |
| InChIKey | DSIUHDFRUMCVBM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.85 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(3,5-dimethoxyphenyl)-methoxymethyl]-7-methoxyisoquinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,5-dimethoxyphenyl)-methoxymethyl]-7-methoxyisoquinoline;hydrochloride?
The IUPAC name of 4-[(3,5-dimethoxyphenyl)-methoxymethyl]-7-methoxyisoquinoline;hydrochloride (CID 89481927) is 4-[(3,5-dimethoxyphenyl)-methoxymethyl]-7-methoxyisoquinoline;hydrochloride.
What is the SMILES notation for 4-[(3,5-dimethoxyphenyl)-methoxymethyl]-7-methoxyisoquinoline;hydrochloride?
The canonical SMILES for 4-[(3,5-dimethoxyphenyl)-methoxymethyl]-7-methoxyisoquinoline;hydrochloride is COc1cc(OC)cc(C(OC)c2cncc3cc(OC)ccc23)c1.Cl.
What is the InChIKey of 4-[(3,5-dimethoxyphenyl)-methoxymethyl]-7-methoxyisoquinoline;hydrochloride?
The InChIKey is DSIUHDFRUMCVBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO4.ClH/c1-22-15-5-6-18-14(9-15)11-21-12-19(18)20(25-4)13-7-16(23-2)10-17(8-13)24-3;/h5-12,20H,1-4H3;1H.
What are the key properties of 4-[(3,5-dimethoxyphenyl)-methoxymethyl]-7-methoxyisoquinoline;hydrochloride?
4-[(3,5-dimethoxyphenyl)-methoxymethyl]-7-methoxyisoquinoline;hydrochloride has a molecular weight of 375.85 g/mol, XLogP of 4.42, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,5-dimethoxyphenyl)-methoxymethyl]-7-methoxyisoquinoline;hydrochloride is sourced from PubChem (CID 89481927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).