C28H38N10 — CID 89482649
2-N-[4-[3-(4-methylpiperazin-1-yl)propylamino]phenyl]-8-N-phenyl-9-N-propan-2-ylpurine-2,8,9-triamine (PubChem CID 89482649) has the molecular formula C28H38N10 and a molecular weight of 514.68 g/mol. Its IUPAC name is 2-N-[4-[3-(4-methylpiperazin-1-yl)propylamino]phenyl]-8-N-phenyl-9-N-propan-2-ylpurine-2,8,9-triamine.
| Compound Name | 2-N-[4-[3-(4-methylpiperazin-1-yl)propylamino]phenyl]-8-N-phenyl-9-N-propan-2-ylpurine-2,8,9-triamine |
|---|---|
| PubChem CID | 89482649 |
| Molecular Formula | C28H38N10 |
| Molecular Weight | 514.68 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | 2-N-[4-[3-(4-methylpiperazin-1-yl)propylamino]phenyl]-8-N-phenyl-9-N-propan-2-ylpurine-2,8,9-triamine |
| SMILES | CC(C)Nn1c(Nc2ccccc2)nc2cnc(Nc3ccc(NCCCN4CCN(C)CC4)cc3)nc21 |
| InChI | InChI=1S/C28H38N10/c1-21(2)35-38-26-25(33-28(38)32-23-8-5-4-6-9-23)20-30-27(34-26)31-24-12-10-22(11-13-24)29-14-7-15-37-18-16-36(3)17-19-37/h4-6,8-13,20-21,29,35H,7,14-19H2,1-3H3,(H,32,33)(H,30,31,34) |
| InChIKey | PCMKWUDGTSOJIM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 98.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.68 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|