About 4-[4-(4-methoxyphenyl)triazol-1-yl]pyridine-2,6-dicarboxylic acid
4-[4-(4-methoxyphenyl)triazol-1-yl]pyridine-2,6-dicarboxylic acid (PubChem CID 89482650) has the molecular formula C16H12N4O5
and a molecular weight of 340.30 g/mol. Its IUPAC name is 4-[4-(4-methoxyphenyl)triazol-1-yl]pyridine-2,6-dicarboxylic acid.
Molecular Properties
| Compound Name | 4-[4-(4-methoxyphenyl)triazol-1-yl]pyridine-2,6-dicarboxylic acid |
| PubChem CID | 89482650 |
| Molecular Formula | C16H12N4O5 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 4-[4-(4-methoxyphenyl)triazol-1-yl]pyridine-2,6-dicarboxylic acid |
| SMILES | COc1ccc(-c2cn(-c3cc(C(=O)O)nc(C(=O)O)c3)nn2)cc1 |
| InChI | InChI=1S/C16H12N4O5/c1-25-11-4-2-9(3-5-11)14-8-20(19-18-14)10-6-12(15(21)22)17-13(7-10)16(23)24/h2-8H,1H3,(H,21,22)(H,23,24) |
| InChIKey | QRFXWTAWNJAUMK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 127.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[4-(4-methoxyphenyl)triazol-1-yl]pyridine-2,6-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-methoxyphenyl)triazol-1-yl]pyridine-2,6-dicarboxylic acid?
The IUPAC name of 4-[4-(4-methoxyphenyl)triazol-1-yl]pyridine-2,6-dicarboxylic acid (CID 89482650) is 4-[4-(4-methoxyphenyl)triazol-1-yl]pyridine-2,6-dicarboxylic acid.
What is the SMILES notation for 4-[4-(4-methoxyphenyl)triazol-1-yl]pyridine-2,6-dicarboxylic acid?
The canonical SMILES for 4-[4-(4-methoxyphenyl)triazol-1-yl]pyridine-2,6-dicarboxylic acid is COc1ccc(-c2cn(-c3cc(C(=O)O)nc(C(=O)O)c3)nn2)cc1.
What is the InChIKey of 4-[4-(4-methoxyphenyl)triazol-1-yl]pyridine-2,6-dicarboxylic acid?
The InChIKey is QRFXWTAWNJAUMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4O5/c1-25-11-4-2-9(3-5-11)14-8-20(19-18-14)10-6-12(15(21)22)17-13(7-10)16(23)24/h2-8H,1H3,(H,21,22)(H,23,24).
What are the key properties of 4-[4-(4-methoxyphenyl)triazol-1-yl]pyridine-2,6-dicarboxylic acid?
4-[4-(4-methoxyphenyl)triazol-1-yl]pyridine-2,6-dicarboxylic acid has a molecular weight of 340.30 g/mol, XLogP of 1.73, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-methoxyphenyl)triazol-1-yl]pyridine-2,6-dicarboxylic acid is sourced from PubChem (CID 89482650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).