C24H31ClN4O3S — CID 89482720
2-amino-N-[[1-[4-(benzenesulfonyl)piperazin-1-yl]cyclohexyl]methyl]-6-chlorobenzamide (PubChem CID 89482720) has the molecular formula C24H31ClN4O3S and a molecular weight of 491.06 g/mol. Its IUPAC name is 2-amino-N-[[1-[4-(benzenesulfonyl)piperazin-1-yl]cyclohexyl]methyl]-6-chlorobenzamide.
| Compound Name | 2-amino-N-[[1-[4-(benzenesulfonyl)piperazin-1-yl]cyclohexyl]methyl]-6-chlorobenzamide |
|---|---|
| PubChem CID | 89482720 |
| Molecular Formula | C24H31ClN4O3S |
| Molecular Weight | 491.06 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 2-amino-N-[[1-[4-(benzenesulfonyl)piperazin-1-yl]cyclohexyl]methyl]-6-chlorobenzamide |
| SMILES | Nc1cccc(Cl)c1C(=O)NCC1(N2CCN(S(=O)(=O)c3ccccc3)CC2)CCCCC1 |
| InChI | InChI=1S/C24H31ClN4O3S/c25-20-10-7-11-21(26)22(20)23(30)27-18-24(12-5-2-6-13-24)28-14-16-29(17-15-28)33(31,32)19-8-3-1-4-9-19/h1,3-4,7-11H,2,5-6,12-18,26H2,(H,27,30) |
| InChIKey | OXHDVKXNKDMECC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.06 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|