C11H19NO8S — CID 89482746
3-acetyl-2-(2,2,3,4,5-pentahydroxypentyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 89482746) has the molecular formula C11H19NO8S and a molecular weight of 325.34 g/mol. Its IUPAC name is 3-acetyl-2-(2,2,3,4,5-pentahydroxypentyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 3-acetyl-2-(2,2,3,4,5-pentahydroxypentyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 89482746 |
| Molecular Formula | C11H19NO8S |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 3-acetyl-2-(2,2,3,4,5-pentahydroxypentyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC(=O)N1C(CC(O)(O)C(O)C(O)CO)SCC1C(=O)O |
| InChI | InChI=1S/C11H19NO8S/c1-5(14)12-6(10(17)18)4-21-8(12)2-11(19,20)9(16)7(15)3-13/h6-9,13,15-16,19-20H,2-4H2,1H3,(H,17,18) |
| InChIKey | CHIMGRFOCXYMMQ-UHFFFAOYSA-N |
| XLogP | -2.85 |
| TPSA | 158.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|