4-methylhepta-1,6-dien-4-amine;sulfuric acid

C8H17NO4S — CID 89482933

IUPAC4-methylhepta-1,6-dien-4-amine;sulfuric acid
SMILESC=CCC(C)(N)CC=C.O=S(=O)(O)O
InChIInChI=1S/C8H15N.H2O4S/c1-4-6-8(3,9)7-5-2;1-5(2,3)4/h4-5H,1-2,6-7,9H2,3H3;(H2,1,2,3,4)
InChIKeyZRGZRXZWNJQPJJ-UHFFFAOYSA-N
MW223.29 g/mol
LogP1.20
Rot. Bonds4

About 4-methylhepta-1,6-dien-4-amine;sulfuric acid

4-methylhepta-1,6-dien-4-amine;sulfuric acid (PubChem CID 89482933) has the molecular formula C8H17NO4S and a molecular weight of 223.29 g/mol. Its IUPAC name is 4-methylhepta-1,6-dien-4-amine;sulfuric acid.

Molecular Properties

Compound Name4-methylhepta-1,6-dien-4-amine;sulfuric acid
PubChem CID89482933
Molecular FormulaC8H17NO4S
Molecular Weight223.29 g/mol
Exact Mass223.09
IUPAC Name4-methylhepta-1,6-dien-4-amine;sulfuric acid
SMILESC=CCC(C)(N)CC=C.O=S(=O)(O)O
InChIInChI=1S/C8H15N.H2O4S/c1-4-6-8(3,9)7-5-2;1-5(2,3)4/h4-5H,1-2,6-7,9H2,3H3;(H2,1,2,3,4)
InChIKeyZRGZRXZWNJQPJJ-UHFFFAOYSA-N
XLogP1.20
TPSA100.62 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.29
LogP ≤ 51.20
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 4-methylhepta-1,6-dien-4-amine;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methylhepta-1,6-dien-4-amine;sulfuric acid?
The IUPAC name of 4-methylhepta-1,6-dien-4-amine;sulfuric acid (CID 89482933) is 4-methylhepta-1,6-dien-4-amine;sulfuric acid.
What is the SMILES notation for 4-methylhepta-1,6-dien-4-amine;sulfuric acid?
The canonical SMILES for 4-methylhepta-1,6-dien-4-amine;sulfuric acid is C=CCC(C)(N)CC=C.O=S(=O)(O)O.
What is the InChIKey of 4-methylhepta-1,6-dien-4-amine;sulfuric acid?
The InChIKey is ZRGZRXZWNJQPJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N.H2O4S/c1-4-6-8(3,9)7-5-2;1-5(2,3)4/h4-5H,1-2,6-7,9H2,3H3;(H2,1,2,3,4).
What are the key properties of 4-methylhepta-1,6-dien-4-amine;sulfuric acid?
4-methylhepta-1,6-dien-4-amine;sulfuric acid has a molecular weight of 223.29 g/mol, XLogP of 1.20, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylhepta-1,6-dien-4-amine;sulfuric acid is sourced from PubChem (CID 89482933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).