About 2-chloro-4-[2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]benzonitrile
2-chloro-4-[2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]benzonitrile (PubChem CID 89483294) has the molecular formula C13H12ClF3N2O
and a molecular weight of 304.70 g/mol. Its IUPAC name is 2-chloro-4-[2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]benzonitrile.
Molecular Properties
| Compound Name | 2-chloro-4-[2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]benzonitrile |
| PubChem CID | 89483294 |
| Molecular Formula | C13H12ClF3N2O |
| Molecular Weight | 304.70 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-chloro-4-[2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CCCC2[C@@H](O)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H12ClF3N2O/c14-10-6-9(4-3-8(10)7-18)19-5-1-2-11(19)12(20)13(15,16)17/h3-4,6,11-12,20H,1-2,5H2/t11?,12-/m1/s1 |
| InChIKey | HMYZEDPXEOXVDF-PIJUOVFKSA-N |
| XLogP | 3.10 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.70 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-4-[2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-[2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]benzonitrile?
The IUPAC name of 2-chloro-4-[2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]benzonitrile (CID 89483294) is 2-chloro-4-[2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]benzonitrile.
What is the SMILES notation for 2-chloro-4-[2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]benzonitrile?
The canonical SMILES for 2-chloro-4-[2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]benzonitrile is N#Cc1ccc(N2CCCC2[C@@H](O)C(F)(F)F)cc1Cl.
What is the InChIKey of 2-chloro-4-[2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]benzonitrile?
The InChIKey is HMYZEDPXEOXVDF-PIJUOVFKSA-N. The full InChI is InChI=1S/C13H12ClF3N2O/c14-10-6-9(4-3-8(10)7-18)19-5-1-2-11(19)12(20)13(15,16)17/h3-4,6,11-12,20H,1-2,5H2/t11?,12-/m1/s1.
What are the key properties of 2-chloro-4-[2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]benzonitrile?
2-chloro-4-[2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]benzonitrile has a molecular weight of 304.70 g/mol, XLogP of 3.10, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-[2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]benzonitrile is sourced from PubChem (CID 89483294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).