C13H9F5O7 — CID 89483894
(1,1,1,3,3-pentafluoro-4,5-dioxopentan-2-yl) 5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 89483894) has the molecular formula C13H9F5O7 and a molecular weight of 372.20 g/mol. Its IUPAC name is (1,1,1,3,3-pentafluoro-4,5-dioxopentan-2-yl) 5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | (1,1,1,3,3-pentafluoro-4,5-dioxopentan-2-yl) 5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 89483894 |
| Molecular Formula | C13H9F5O7 |
| Molecular Weight | 372.20 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | (1,1,1,3,3-pentafluoro-4,5-dioxopentan-2-yl) 5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | O=CC(=O)C(F)(F)C(OC(=O)C1C2CC3OC(=O)C1C3O2)C(F)(F)F |
| InChI | InChI=1S/C13H9F5O7/c14-12(15,5(20)2-19)11(13(16,17)18)25-9(21)6-3-1-4-8(23-3)7(6)10(22)24-4/h2-4,6-8,11H,1H2 |
| InChIKey | MBNAWGUAJQVMDT-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.20 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|