C32H47F2NO2 — CID 89483944
(2S,5S)-2-(dibenzylamino)-9,9-difluoro-5-hydroxyoctadecan-3-one (PubChem CID 89483944) has the molecular formula C32H47F2NO2 and a molecular weight of 515.73 g/mol. Its IUPAC name is (2S,5S)-2-(dibenzylamino)-9,9-difluoro-5-hydroxyoctadecan-3-one.
| Compound Name | (2S,5S)-2-(dibenzylamino)-9,9-difluoro-5-hydroxyoctadecan-3-one |
|---|---|
| PubChem CID | 89483944 |
| Molecular Formula | C32H47F2NO2 |
| Molecular Weight | 515.73 g/mol |
| Exact Mass | 515.36 |
| IUPAC Name | (2S,5S)-2-(dibenzylamino)-9,9-difluoro-5-hydroxyoctadecan-3-one |
| SMILES | CCCCCCCCCC(F)(F)CCC[C@H](O)CC(=O)[C@H](C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C32H47F2NO2/c1-3-4-5-6-7-8-15-22-32(33,34)23-16-21-30(36)24-31(37)27(2)35(25-28-17-11-9-12-18-28)26-29-19-13-10-14-20-29/h9-14,17-20,27,30,36H,3-8,15-16,21-26H2,1-2H3/t27-,30-/m0/s1 |
| InChIKey | IRDCYWKKYNDLBN-FIBWVYCGSA-N |
| XLogP | 8.34 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.73 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|