C37H28Br2F6S6 — CID 89484017
2-(5-bromothiophen-2-yl)-3-[2-[2-(5-bromothiophen-2-yl)-5-(5-tert-butylthiophen-2-yl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-(5-tert-butylthiophen-2-yl)thiophene (PubChem CID 89484017) has the molecular formula C37H28Br2F6S6 and a molecular weight of 938.83 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-3-[2-[2-(5-bromothiophen-2-yl)-5-(5-tert-butylthiophen-2-yl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-(5-tert-butylthiophen-2-yl)thiophene.
| Compound Name | 2-(5-bromothiophen-2-yl)-3-[2-[2-(5-bromothiophen-2-yl)-5-(5-tert-butylthiophen-2-yl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-(5-tert-butylthiophen-2-yl)thiophene |
|---|---|
| PubChem CID | 89484017 |
| Molecular Formula | C37H28Br2F6S6 |
| Molecular Weight | 938.83 g/mol |
| Exact Mass | 935.88 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-3-[2-[2-(5-bromothiophen-2-yl)-5-(5-tert-butylthiophen-2-yl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-(5-tert-butylthiophen-2-yl)thiophene |
| SMILES | CC(C)(C)c1ccc(-c2cc(C3=C(c4cc(-c5ccc(C(C)(C)C)s5)sc4-c4ccc(Br)s4)C(F)(F)C(F)(F)C3(F)F)c(-c3ccc(Br)s3)s2)s1 |
| InChI | InChI=1S/C37H28Br2F6S6/c1-33(2,3)25-11-7-19(46-25)23-15-17(31(50-23)21-9-13-27(38)48-21)29-30(36(42,43)37(44,45)35(29,40)41)18-16-24(20-8-12-26(47-20)34(4,5)6)51-32(18)22-10-14-28(39)49-22/h7-16H,1-6H3 |
| InChIKey | JDDDABGBJCFXCG-UHFFFAOYSA-N |
| XLogP | 16.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 938.83 |
| LogP ≤ 5 | 16.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|