C24H17F7O3 — CID 89484023
6-(4-tert-butylphenyl)-7-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)furo[2,3-f][1,3]benzodioxole (PubChem CID 89484023) has the molecular formula C24H17F7O3 and a molecular weight of 486.38 g/mol. Its IUPAC name is 6-(4-tert-butylphenyl)-7-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)furo[2,3-f][1,3]benzodioxole.
| Compound Name | 6-(4-tert-butylphenyl)-7-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)furo[2,3-f][1,3]benzodioxole |
|---|---|
| PubChem CID | 89484023 |
| Molecular Formula | C24H17F7O3 |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 6-(4-tert-butylphenyl)-7-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)furo[2,3-f][1,3]benzodioxole |
| SMILES | CC(C)(C)c1ccc(-c2oc3cc4c(cc3c2C2=C(F)C(F)(F)C(F)(F)C2(F)F)OCO4)cc1 |
| InChI | InChI=1S/C24H17F7O3/c1-21(2,3)12-6-4-11(5-7-12)19-17(13-8-15-16(33-10-32-15)9-14(13)34-19)18-20(25)23(28,29)24(30,31)22(18,26)27/h4-9H,10H2,1-3H3 |
| InChIKey | DXENJDMKLZKBJN-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|