C29H10Br4F6S6 — CID 89484026
3-[2-[2,5-bis(5-bromothiophen-2-yl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-bis(5-bromothiophen-2-yl)thiophene (PubChem CID 89484026) has the molecular formula C29H10Br4F6S6 and a molecular weight of 984.40 g/mol. Its IUPAC name is 3-[2-[2,5-bis(5-bromothiophen-2-yl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-bis(5-bromothiophen-2-yl)thiophene.
| Compound Name | 3-[2-[2,5-bis(5-bromothiophen-2-yl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-bis(5-bromothiophen-2-yl)thiophene |
|---|---|
| PubChem CID | 89484026 |
| Molecular Formula | C29H10Br4F6S6 |
| Molecular Weight | 984.40 g/mol |
| Exact Mass | 979.57 |
| IUPAC Name | 3-[2-[2,5-bis(5-bromothiophen-2-yl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-bis(5-bromothiophen-2-yl)thiophene |
| SMILES | FC1(F)C(c2cc(-c3ccc(Br)s3)sc2-c2ccc(Br)s2)=C(c2cc(-c3ccc(Br)s3)sc2-c2ccc(Br)s2)C(F)(F)C1(F)F |
| InChI | InChI=1S/C29H10Br4F6S6/c30-19-5-1-13(40-19)17-9-11(25(44-17)15-3-7-21(32)42-15)23-24(28(36,37)29(38,39)27(23,34)35)12-10-18(14-2-6-20(31)41-14)45-26(12)16-4-8-22(33)43-16/h1-10H |
| InChIKey | DTOZDWVNJXAZDM-UHFFFAOYSA-N |
| XLogP | 15.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 984.40 |
| LogP ≤ 5 | 15.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|