C29H10F6N4O8S6 — CID 89484041
3-[2-[2,5-bis(5-nitrothiophen-2-yl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-bis(5-nitrothiophen-2-yl)thiophene (PubChem CID 89484041) has the molecular formula C29H10F6N4O8S6 and a molecular weight of 848.81 g/mol. Its IUPAC name is 3-[2-[2,5-bis(5-nitrothiophen-2-yl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-bis(5-nitrothiophen-2-yl)thiophene.
| Compound Name | 3-[2-[2,5-bis(5-nitrothiophen-2-yl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-bis(5-nitrothiophen-2-yl)thiophene |
|---|---|
| PubChem CID | 89484041 |
| Molecular Formula | C29H10F6N4O8S6 |
| Molecular Weight | 848.81 g/mol |
| Exact Mass | 847.87 |
| IUPAC Name | 3-[2-[2,5-bis(5-nitrothiophen-2-yl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-bis(5-nitrothiophen-2-yl)thiophene |
| SMILES | O=[N+]([O-])c1ccc(-c2cc(C3=C(c4cc(-c5ccc([N+](=O)[O-])s5)sc4-c4ccc([N+](=O)[O-])s4)C(F)(F)C(F)(F)C3(F)F)c(-c3ccc([N+](=O)[O-])s3)s2)s1 |
| InChI | InChI=1S/C29H10F6N4O8S6/c30-27(31)23(11-9-17(13-1-5-19(48-13)36(40)41)52-25(11)15-3-7-21(50-15)38(44)45)24(28(32,33)29(27,34)35)12-10-18(14-2-6-20(49-14)37(42)43)53-26(12)16-4-8-22(51-16)39(46)47/h1-10H |
| InChIKey | PKHHVJZYMQMUFB-UHFFFAOYSA-N |
| XLogP | 12.19 |
| TPSA | 172.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.81 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|