C43H34F6O6 — CID 89484098
6-(4-tert-butylphenyl)-7-[2-[6-(4-tert-butylphenyl)furo[2,3-f][1,3]benzodioxol-7-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]furo[2,3-f][1,3]benzodioxole (PubChem CID 89484098) has the molecular formula C43H34F6O6 and a molecular weight of 760.73 g/mol. Its IUPAC name is 6-(4-tert-butylphenyl)-7-[2-[6-(4-tert-butylphenyl)furo[2,3-f][1,3]benzodioxol-7-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]furo[2,3-f][1,3]benzodioxole.
| Compound Name | 6-(4-tert-butylphenyl)-7-[2-[6-(4-tert-butylphenyl)furo[2,3-f][1,3]benzodioxol-7-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]furo[2,3-f][1,3]benzodioxole |
|---|---|
| PubChem CID | 89484098 |
| Molecular Formula | C43H34F6O6 |
| Molecular Weight | 760.73 g/mol |
| Exact Mass | 760.23 |
| IUPAC Name | 6-(4-tert-butylphenyl)-7-[2-[6-(4-tert-butylphenyl)furo[2,3-f][1,3]benzodioxol-7-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]furo[2,3-f][1,3]benzodioxole |
| SMILES | CC(C)(C)c1ccc(-c2oc3cc4c(cc3c2C2=C(c3c(-c5ccc(C(C)(C)C)cc5)oc5cc6c(cc35)OCO6)C(F)(F)C(F)(F)C2(F)F)OCO4)cc1 |
| InChI | InChI=1S/C43H34F6O6/c1-39(2,3)23-11-7-21(8-12-23)37-33(25-15-29-31(52-19-50-29)17-27(25)54-37)35-36(42(46,47)43(48,49)41(35,44)45)34-26-16-30-32(53-20-51-30)18-28(26)55-38(34)22-9-13-24(14-10-22)40(4,5)6/h7-18H,19-20H2,1-6H3 |
| InChIKey | GPTPTFYOLBUDAQ-UHFFFAOYSA-N |
| XLogP | 12.40 |
| TPSA | 63.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.73 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|