C9H15F3N2O3 — CID 89484159
2,2,2-trifluoro-N-[(3S,4S)-1-[formyl(methyl)amino]-4-hydroxypentan-3-yl]acetamide (PubChem CID 89484159) has the molecular formula C9H15F3N2O3 and a molecular weight of 256.22 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(3S,4S)-1-[formyl(methyl)amino]-4-hydroxypentan-3-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(3S,4S)-1-[formyl(methyl)amino]-4-hydroxypentan-3-yl]acetamide |
|---|---|
| PubChem CID | 89484159 |
| Molecular Formula | C9H15F3N2O3 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2,2,2-trifluoro-N-[(3S,4S)-1-[formyl(methyl)amino]-4-hydroxypentan-3-yl]acetamide |
| SMILES | C[C@H](O)[C@H](CCN(C)C=O)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H15F3N2O3/c1-6(16)7(3-4-14(2)5-15)13-8(17)9(10,11)12/h5-7,16H,3-4H2,1-2H3,(H,13,17)/t6-,7-/m0/s1 |
| InChIKey | DXBFNCVVUGMODO-BQBZGAKWSA-N |
| XLogP | -0.11 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|