About [(2Z)-2-cyclohexa-2,4-dien-1-ylidene-2-(2-ethenylphenyl)ethyl] carboniodidate
[(2Z)-2-cyclohexa-2,4-dien-1-ylidene-2-(2-ethenylphenyl)ethyl] carboniodidate (PubChem CID 89484176) has the molecular formula C17H15IO2
and a molecular weight of 378.21 g/mol. Its IUPAC name is [(2Z)-2-cyclohexa-2,4-dien-1-ylidene-2-(2-ethenylphenyl)ethyl] carboniodidate.
Molecular Properties
| Compound Name | [(2Z)-2-cyclohexa-2,4-dien-1-ylidene-2-(2-ethenylphenyl)ethyl] carboniodidate |
| PubChem CID | 89484176 |
| Molecular Formula | C17H15IO2 |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | [(2Z)-2-cyclohexa-2,4-dien-1-ylidene-2-(2-ethenylphenyl)ethyl] carboniodidate |
| SMILES | C=Cc1ccccc1/C(COC(=O)I)=C1/C=CC=CC1 |
| InChI | InChI=1S/C17H15IO2/c1-2-13-8-6-7-11-15(13)16(12-20-17(18)19)14-9-4-3-5-10-14/h2-9,11H,1,10,12H2/b16-14- |
| InChIKey | SAAIYDQRGITJTC-PEZBUJJGSA-N |
| XLogP | 5.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(2Z)-2-cyclohexa-2,4-dien-1-ylidene-2-(2-ethenylphenyl)ethyl] carboniodidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2Z)-2-cyclohexa-2,4-dien-1-ylidene-2-(2-ethenylphenyl)ethyl] carboniodidate?
The IUPAC name of [(2Z)-2-cyclohexa-2,4-dien-1-ylidene-2-(2-ethenylphenyl)ethyl] carboniodidate (CID 89484176) is [(2Z)-2-cyclohexa-2,4-dien-1-ylidene-2-(2-ethenylphenyl)ethyl] carboniodidate.
What is the SMILES notation for [(2Z)-2-cyclohexa-2,4-dien-1-ylidene-2-(2-ethenylphenyl)ethyl] carboniodidate?
The canonical SMILES for [(2Z)-2-cyclohexa-2,4-dien-1-ylidene-2-(2-ethenylphenyl)ethyl] carboniodidate is C=Cc1ccccc1/C(COC(=O)I)=C1/C=CC=CC1.
What is the InChIKey of [(2Z)-2-cyclohexa-2,4-dien-1-ylidene-2-(2-ethenylphenyl)ethyl] carboniodidate?
The InChIKey is SAAIYDQRGITJTC-PEZBUJJGSA-N. The full InChI is InChI=1S/C17H15IO2/c1-2-13-8-6-7-11-15(13)16(12-20-17(18)19)14-9-4-3-5-10-14/h2-9,11H,1,10,12H2/b16-14-.
What are the key properties of [(2Z)-2-cyclohexa-2,4-dien-1-ylidene-2-(2-ethenylphenyl)ethyl] carboniodidate?
[(2Z)-2-cyclohexa-2,4-dien-1-ylidene-2-(2-ethenylphenyl)ethyl] carboniodidate has a molecular weight of 378.21 g/mol, XLogP of 5.17, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z)-2-cyclohexa-2,4-dien-1-ylidene-2-(2-ethenylphenyl)ethyl] carboniodidate is sourced from PubChem (CID 89484176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).