C24H49N — CID 89484286
3,4,5,6,7-pentaethyl-3,4,5,6,7-pentamethylnonan-2-imine (PubChem CID 89484286) has the molecular formula C24H49N and a molecular weight of 351.66 g/mol. Its IUPAC name is 3,4,5,6,7-pentaethyl-3,4,5,6,7-pentamethylnonan-2-imine.
| Compound Name | 3,4,5,6,7-pentaethyl-3,4,5,6,7-pentamethylnonan-2-imine |
|---|---|
| PubChem CID | 89484286 |
| Molecular Formula | C24H49N |
| Molecular Weight | 351.66 g/mol |
| Exact Mass | 351.39 |
| IUPAC Name | 3,4,5,6,7-pentaethyl-3,4,5,6,7-pentamethylnonan-2-imine |
| SMILES | [H]/N=C(\C)C(C)(CC)C(C)(CC)C(C)(CC)C(C)(CC)C(C)(CC)CC |
| InChI | InChI=1S/C24H49N/c1-13-20(8,14-2)22(10,16-4)24(12,18-6)23(11,17-5)21(9,15-3)19(7)25/h25H,13-18H2,1-12H3/b25-19+ |
| InChIKey | CCXIOCXQHYXTGP-NCELDCMTSA-N |
| XLogP | 8.52 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.66 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|