About 1-amino-3,4-dimethylpyrrolidine-2,5-dione
1-amino-3,4-dimethylpyrrolidine-2,5-dione (PubChem CID 89484333) has the molecular formula C6H10N2O2
and a molecular weight of 142.16 g/mol. Its IUPAC name is 1-amino-3,4-dimethylpyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 1-amino-3,4-dimethylpyrrolidine-2,5-dione |
| PubChem CID | 89484333 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 1-amino-3,4-dimethylpyrrolidine-2,5-dione |
| SMILES | CC1C(=O)N(N)C(=O)C1C |
| InChI | InChI=1S/C6H10N2O2/c1-3-4(2)6(10)8(7)5(3)9/h3-4H,7H2,1-2H3 |
| InChIKey | HZJNYJGOFZGIEA-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3,4-dimethylpyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3,4-dimethylpyrrolidine-2,5-dione?
The IUPAC name of 1-amino-3,4-dimethylpyrrolidine-2,5-dione (CID 89484333) is 1-amino-3,4-dimethylpyrrolidine-2,5-dione.
What is the SMILES notation for 1-amino-3,4-dimethylpyrrolidine-2,5-dione?
The canonical SMILES for 1-amino-3,4-dimethylpyrrolidine-2,5-dione is CC1C(=O)N(N)C(=O)C1C.
What is the InChIKey of 1-amino-3,4-dimethylpyrrolidine-2,5-dione?
The InChIKey is HZJNYJGOFZGIEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2/c1-3-4(2)6(10)8(7)5(3)9/h3-4H,7H2,1-2H3.
What are the key properties of 1-amino-3,4-dimethylpyrrolidine-2,5-dione?
1-amino-3,4-dimethylpyrrolidine-2,5-dione has a molecular weight of 142.16 g/mol, XLogP of -0.50, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3,4-dimethylpyrrolidine-2,5-dione is sourced from PubChem (CID 89484333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).