About 2-N-ethyl-1-N,3-dimethylbutane-1,2-diamine
2-N-ethyl-1-N,3-dimethylbutane-1,2-diamine (PubChem CID 89484583) has the molecular formula C8H20N2
and a molecular weight of 144.26 g/mol. Its IUPAC name is 2-N-ethyl-1-N,3-dimethylbutane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-ethyl-1-N,3-dimethylbutane-1,2-diamine |
| PubChem CID | 89484583 |
| Molecular Formula | C8H20N2 |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.16 |
| IUPAC Name | 2-N-ethyl-1-N,3-dimethylbutane-1,2-diamine |
| SMILES | CCNC(CNC)C(C)C |
| InChI | InChI=1S/C8H20N2/c1-5-10-8(6-9-4)7(2)3/h7-10H,5-6H2,1-4H3 |
| InChIKey | UHGLPYXYTUSCBJ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-N-ethyl-1-N,3-dimethylbutane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-ethyl-1-N,3-dimethylbutane-1,2-diamine?
The IUPAC name of 2-N-ethyl-1-N,3-dimethylbutane-1,2-diamine (CID 89484583) is 2-N-ethyl-1-N,3-dimethylbutane-1,2-diamine.
What is the SMILES notation for 2-N-ethyl-1-N,3-dimethylbutane-1,2-diamine?
The canonical SMILES for 2-N-ethyl-1-N,3-dimethylbutane-1,2-diamine is CCNC(CNC)C(C)C.
What is the InChIKey of 2-N-ethyl-1-N,3-dimethylbutane-1,2-diamine?
The InChIKey is UHGLPYXYTUSCBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N2/c1-5-10-8(6-9-4)7(2)3/h7-10H,5-6H2,1-4H3.
What are the key properties of 2-N-ethyl-1-N,3-dimethylbutane-1,2-diamine?
2-N-ethyl-1-N,3-dimethylbutane-1,2-diamine has a molecular weight of 144.26 g/mol, XLogP of 0.84, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-ethyl-1-N,3-dimethylbutane-1,2-diamine is sourced from PubChem (CID 89484583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).